C24H28ClN5O3 — CID 58742769
N-[1-(3-amino-3-oxopropyl)-5-[[cyclohexyl(hydroxy)amino]methyl]benzimidazol-2-yl]-4-chlorobenzamide (PubChem CID 58742769) has the molecular formula C24H28ClN5O3 and a molecular weight of 469.97 g/mol. Its IUPAC name is N-[1-(3-amino-3-oxopropyl)-5-[[cyclohexyl(hydroxy)amino]methyl]benzimidazol-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-(3-amino-3-oxopropyl)-5-[[cyclohexyl(hydroxy)amino]methyl]benzimidazol-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 58742769 |
| Molecular Formula | C24H28ClN5O3 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-[1-(3-amino-3-oxopropyl)-5-[[cyclohexyl(hydroxy)amino]methyl]benzimidazol-2-yl]-4-chlorobenzamide |
| SMILES | NC(=O)CCn1c(NC(=O)c2ccc(Cl)cc2)nc2cc(CN(O)C3CCCCC3)ccc21 |
| InChI | InChI=1S/C24H28ClN5O3/c25-18-9-7-17(8-10-18)23(32)28-24-27-20-14-16(15-30(33)19-4-2-1-3-5-19)6-11-21(20)29(24)13-12-22(26)31/h6-11,14,19,33H,1-5,12-13,15H2,(H2,26,31)(H,27,28,32) |
| InChIKey | AHZFNGPXFFALRH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|