C28H32N4O3 — CID 59083118
2-benzamido-N-cyclohexyl-1-(3-oxobutyl)-N-prop-2-enylbenzimidazole-5-carboxamide (PubChem CID 59083118) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-benzamido-N-cyclohexyl-1-(3-oxobutyl)-N-prop-2-enylbenzimidazole-5-carboxamide.
| Compound Name | 2-benzamido-N-cyclohexyl-1-(3-oxobutyl)-N-prop-2-enylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 59083118 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 2-benzamido-N-cyclohexyl-1-(3-oxobutyl)-N-prop-2-enylbenzimidazole-5-carboxamide |
| SMILES | C=CCN(C(=O)c1ccc2c(c1)nc(NC(=O)c1ccccc1)n2CCC(C)=O)C1CCCCC1 |
| InChI | InChI=1S/C28H32N4O3/c1-3-17-31(23-12-8-5-9-13-23)27(35)22-14-15-25-24(19-22)29-28(32(25)18-16-20(2)33)30-26(34)21-10-6-4-7-11-21/h3-4,6-7,10-11,14-15,19,23H,1,5,8-9,12-13,16-18H2,2H3,(H,29,30,34) |
| InChIKey | UKQBRCHIQBDAFY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|