C26H32N4O4S — CID 10117609
6-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]hexanoic acid (PubChem CID 10117609) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol. Its IUPAC name is 6-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]hexanoic acid.
| Compound Name | 6-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 10117609 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 6-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]hexanoic acid |
| SMILES | CN(C(=O)c1ccc2c(c1)nc(NC(=O)c1cccs1)n2CCCCCC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C26H32N4O4S/c1-29(19-9-4-2-5-10-19)25(34)18-13-14-21-20(17-18)27-26(28-24(33)22-11-8-16-35-22)30(21)15-7-3-6-12-23(31)32/h8,11,13-14,16-17,19H,2-7,9-10,12,15H2,1H3,(H,31,32)(H,27,28,33) |
| InChIKey | UPWYVCRMXJLUTR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|