C23H21N5O3S — CID 91611996
N-[1-(3-amino-3-oxopropyl)-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide (PubChem CID 91611996) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[1-(3-amino-3-oxopropyl)-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(3-amino-3-oxopropyl)-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91611996 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[1-(3-amino-3-oxopropyl)-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide |
| SMILES | NC(=O)CCn1c(NC(=O)c2cccs2)nc2cc(NCC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C23H21N5O3S/c24-21(30)10-11-28-18-9-8-16(25-14-19(29)15-5-2-1-3-6-15)13-17(18)26-23(28)27-22(31)20-7-4-12-32-20/h1-9,12-13,25H,10-11,14H2,(H2,24,30)(H,26,27,31) |
| InChIKey | KMBLOQLBQUFICH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |