C28H23FN6O3S — CID 90731498
N-[1-(3-amino-3-oxopropyl)-5-(phenacylamino)benzimidazol-2-yl]-5-(6-fluoro-3-pyridinyl)thiophene-2-carboxamide (PubChem CID 90731498) has the molecular formula C28H23FN6O3S and a molecular weight of 542.60 g/mol. Its IUPAC name is N-[1-(3-amino-3-oxopropyl)-5-(phenacylamino)benzimidazol-2-yl]-5-(6-fluoro-3-pyridinyl)thiophene-2-carboxamide.
| Compound Name | N-[1-(3-amino-3-oxopropyl)-5-(phenacylamino)benzimidazol-2-yl]-5-(6-fluoro-3-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 90731498 |
| Molecular Formula | C28H23FN6O3S |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | N-[1-(3-amino-3-oxopropyl)-5-(phenacylamino)benzimidazol-2-yl]-5-(6-fluoro-3-pyridinyl)thiophene-2-carboxamide |
| SMILES | NC(=O)CCn1c(NC(=O)c2ccc(-c3ccc(F)nc3)s2)nc2cc(NCC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C28H23FN6O3S/c29-25-11-6-18(15-32-25)23-9-10-24(39-23)27(38)34-28-33-20-14-19(7-8-21(20)35(28)13-12-26(30)37)31-16-22(36)17-4-2-1-3-5-17/h1-11,14-15,31H,12-13,16H2,(H2,30,37)(H,33,34,38) |
| InChIKey | FAFDYOXNNCYEEQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|