C26H21N5O4S — CID 91156914
5-(2-methyl-1,3-oxazol-5-yl)-N-[1-(2-oxoethyl)-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide (PubChem CID 91156914) has the molecular formula C26H21N5O4S and a molecular weight of 499.55 g/mol. Its IUPAC name is 5-(2-methyl-1,3-oxazol-5-yl)-N-[1-(2-oxoethyl)-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-(2-methyl-1,3-oxazol-5-yl)-N-[1-(2-oxoethyl)-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91156914 |
| Molecular Formula | C26H21N5O4S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 5-(2-methyl-1,3-oxazol-5-yl)-N-[1-(2-oxoethyl)-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide |
| SMILES | Cc1ncc(-c2ccc(C(=O)Nc3nc4cc(NCC(=O)c5ccccc5)ccc4n3CC=O)s2)o1 |
| InChI | InChI=1S/C26H21N5O4S/c1-16-27-15-22(35-16)23-9-10-24(36-23)25(34)30-26-29-19-13-18(7-8-20(19)31(26)11-12-32)28-14-21(33)17-5-3-2-4-6-17/h2-10,12-13,15,28H,11,14H2,1H3,(H,29,30,34) |
| InChIKey | SBNRNUHSRSLZPL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 119.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|