C27H26N6O5S2 — CID 91084715
N-[1-[2-(methylsulfonylmethylamino)ethyl]-5-(phenacylamino)benzimidazol-2-yl]-5-(1,3-oxazol-5-yl)thiophene-2-carboxamide (PubChem CID 91084715) has the molecular formula C27H26N6O5S2 and a molecular weight of 578.68 g/mol. Its IUPAC name is N-[1-[2-(methylsulfonylmethylamino)ethyl]-5-(phenacylamino)benzimidazol-2-yl]-5-(1,3-oxazol-5-yl)thiophene-2-carboxamide.
| Compound Name | N-[1-[2-(methylsulfonylmethylamino)ethyl]-5-(phenacylamino)benzimidazol-2-yl]-5-(1,3-oxazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91084715 |
| Molecular Formula | C27H26N6O5S2 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | N-[1-[2-(methylsulfonylmethylamino)ethyl]-5-(phenacylamino)benzimidazol-2-yl]-5-(1,3-oxazol-5-yl)thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)CNCCn1c(NC(=O)c2ccc(-c3cnco3)s2)nc2cc(NCC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C27H26N6O5S2/c1-40(36,37)17-28-11-12-33-21-8-7-19(30-14-22(34)18-5-3-2-4-6-18)13-20(21)31-27(33)32-26(35)25-10-9-24(39-25)23-15-29-16-38-23/h2-10,13,15-16,28,30H,11-12,14,17H2,1H3,(H,31,32,35) |
| InChIKey | SIMGEXBLEIRYCH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 148.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|