C29H37N6O4+ — CID 59083093
[4-[[1-(5-amino-5-oxopentyl)-5-[cyclohexyl(ethyl)carbamoyl]benzimidazol-2-yl]carbamoyl]phenyl]-methyl-oxoazanium (PubChem CID 59083093) has the molecular formula C29H37N6O4+ and a molecular weight of 533.65 g/mol. Its IUPAC name is [4-[[1-(5-amino-5-oxopentyl)-5-[cyclohexyl(ethyl)carbamoyl]benzimidazol-2-yl]carbamoyl]phenyl]-methyl-oxoazanium.
| Compound Name | [4-[[1-(5-amino-5-oxopentyl)-5-[cyclohexyl(ethyl)carbamoyl]benzimidazol-2-yl]carbamoyl]phenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 59083093 |
| Molecular Formula | C29H37N6O4+ |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | [4-[[1-(5-amino-5-oxopentyl)-5-[cyclohexyl(ethyl)carbamoyl]benzimidazol-2-yl]carbamoyl]phenyl]-methyl-oxoazanium |
| SMILES | CCN(C(=O)c1ccc2c(c1)nc(NC(=O)c1ccc([N+](C)=O)cc1)n2CCCCC(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C29H36N6O4/c1-3-34(23-9-5-4-6-10-23)28(38)21-14-17-25-24(19-21)31-29(35(25)18-8-7-11-26(30)36)32-27(37)20-12-15-22(16-13-20)33(2)39/h12-17,19,23H,3-11,18H2,1-2H3,(H2-,30,31,32,36,37)/p+1 |
| InChIKey | BPRAUEMSUZLWNU-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|