C17H10ClF13N2O2 — CID 587428
4-chloro-N'-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4-oxodec-2-en-2-yl)benzohydrazide (PubChem CID 587428) has the molecular formula C17H10ClF13N2O2 and a molecular weight of 556.71 g/mol. Its IUPAC name is 4-chloro-N'-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4-oxodec-2-en-2-yl)benzohydrazide.
| Compound Name | 4-chloro-N'-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4-oxodec-2-en-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 587428 |
| Molecular Formula | C17H10ClF13N2O2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | 4-chloro-N'-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4-oxodec-2-en-2-yl)benzohydrazide |
| SMILES | CC(=CC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H10ClF13N2O2/c1-7(32-33-11(35)8-2-4-9(18)5-3-8)6-10(34)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)31/h2-6,32H,1H3,(H,33,35) |
| InChIKey | VJZVBFNUYUMQGK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|