C21H25N3O3 — CID 58745647
(3-aminophenyl)-[6-[3,4-bis(methoxymethyl)phenyl]-4,5-dihydro-3H-pyridazin-2-yl]methanone (PubChem CID 58745647) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3-aminophenyl)-[6-[3,4-bis(methoxymethyl)phenyl]-4,5-dihydro-3H-pyridazin-2-yl]methanone.
| Compound Name | (3-aminophenyl)-[6-[3,4-bis(methoxymethyl)phenyl]-4,5-dihydro-3H-pyridazin-2-yl]methanone |
|---|---|
| PubChem CID | 58745647 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (3-aminophenyl)-[6-[3,4-bis(methoxymethyl)phenyl]-4,5-dihydro-3H-pyridazin-2-yl]methanone |
| SMILES | COCc1ccc(C2=NN(C(=O)c3cccc(N)c3)CCC2)cc1COC |
| InChI | InChI=1S/C21H25N3O3/c1-26-13-17-9-8-15(11-18(17)14-27-2)20-7-4-10-24(23-20)21(25)16-5-3-6-19(22)12-16/h3,5-6,8-9,11-12H,4,7,10,13-14,22H2,1-2H3 |
| InChIKey | FNBMBCMFIPLTSY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|