C17H13Br2Cl2N3O — CID 21479608
[6-(4-amino-3,5-dibromophenyl)-4,5-dihydro-3H-pyridazin-2-yl]-(3,4-dichlorophenyl)methanone (PubChem CID 21479608) has the molecular formula C17H13Br2Cl2N3O and a molecular weight of 506.03 g/mol. Its IUPAC name is [6-(4-amino-3,5-dibromophenyl)-4,5-dihydro-3H-pyridazin-2-yl]-(3,4-dichlorophenyl)methanone.
| Compound Name | [6-(4-amino-3,5-dibromophenyl)-4,5-dihydro-3H-pyridazin-2-yl]-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 21479608 |
| Molecular Formula | C17H13Br2Cl2N3O |
| Molecular Weight | 506.03 g/mol |
| Exact Mass | 502.88 |
| IUPAC Name | [6-(4-amino-3,5-dibromophenyl)-4,5-dihydro-3H-pyridazin-2-yl]-(3,4-dichlorophenyl)methanone |
| SMILES | Nc1c(Br)cc(C2=NN(C(=O)c3ccc(Cl)c(Cl)c3)CCC2)cc1Br |
| InChI | InChI=1S/C17H13Br2Cl2N3O/c18-11-6-10(7-12(19)16(11)22)15-2-1-5-24(23-15)17(25)9-3-4-13(20)14(21)8-9/h3-4,6-8H,1-2,5,22H2 |
| InChIKey | YHUVMWDNDCNTEW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.03 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|