About 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+)
5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+) (PubChem CID 58746478) has the molecular formula C8H12NRu
and a molecular weight of 223.26 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+).
Molecular Properties
| Compound Name | 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+) |
| PubChem CID | 58746478 |
| Molecular Formula | C8H12NRu |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+) |
| SMILES | CC1=[C-]CC(C(C)C)=N1.[Ru+] |
| InChI | InChI=1S/C8H12N.Ru/c1-6(2)8-5-4-7(3)9-8;/h6H,5H2,1-3H3;/q-1;+1 |
| InChIKey | VFWUGJJMUREOCA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+)?
The IUPAC name of 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+) (CID 58746478) is 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+).
What is the SMILES notation for 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+)?
The canonical SMILES for 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+) is CC1=[C-]CC(C(C)C)=N1.[Ru+].
What is the InChIKey of 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+)?
The InChIKey is VFWUGJJMUREOCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N.Ru/c1-6(2)8-5-4-7(3)9-8;/h6H,5H2,1-3H3;/q-1;+1.
What are the key properties of 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+)?
5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+) has a molecular weight of 223.26 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-propan-2-yl-3,4-dihydropyrrol-4-ide;ruthenium(1+) is sourced from PubChem (CID 58746478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).