C10H16N2O3 — CID 58747624
ethyl 2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)acetate (PubChem CID 58747624) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl 2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)acetate.
| Compound Name | ethyl 2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)acetate |
|---|---|
| PubChem CID | 58747624 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethyl 2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)acetate |
| SMILES | CCOC(=O)Cc1nnc(C(C)(C)C)o1 |
| InChI | InChI=1S/C10H16N2O3/c1-5-14-8(13)6-7-11-12-9(15-7)10(2,3)4/h5-6H2,1-4H3 |
| InChIKey | TZQUHMUJCZLSQE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |