C6H8N2O3 — CID 55212087
ethyl 2-(1,3,4-oxadiazol-2-yl)acetate (PubChem CID 55212087) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is ethyl 2-(1,3,4-oxadiazol-2-yl)acetate.
| Compound Name | ethyl 2-(1,3,4-oxadiazol-2-yl)acetate |
|---|---|
| PubChem CID | 55212087 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | ethyl 2-(1,3,4-oxadiazol-2-yl)acetate |
| SMILES | CCOC(=O)Cc1nnco1 |
| InChI | InChI=1S/C6H8N2O3/c1-2-10-6(9)3-5-8-7-4-11-5/h4H,2-3H2,1H3 |
| InChIKey | WOJMTLHPUUHFFI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |