C6H8N2O3S — CID 22759395
ethyl 2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)acetate (PubChem CID 22759395) has the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. Its IUPAC name is ethyl 2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)acetate.
| Compound Name | ethyl 2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)acetate |
|---|---|
| PubChem CID | 22759395 |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | ethyl 2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)acetate |
| SMILES | CCOC(=O)Cc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C6H8N2O3S/c1-2-10-5(9)3-4-7-8-6(12)11-4/h2-3H2,1H3,(H,8,12) |
| InChIKey | MSFGRCQUKFMDPH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|