C16H19N7 — CID 58748667
[6-propyl-5-[(2-pyridin-2-ylimidazol-1-yl)methyl]pyrazin-2-yl]hydrazine (PubChem CID 58748667) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is [6-propyl-5-[(2-pyridin-2-ylimidazol-1-yl)methyl]pyrazin-2-yl]hydrazine.
| Compound Name | [6-propyl-5-[(2-pyridin-2-ylimidazol-1-yl)methyl]pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 58748667 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [6-propyl-5-[(2-pyridin-2-ylimidazol-1-yl)methyl]pyrazin-2-yl]hydrazine |
| SMILES | CCCc1nc(NN)cnc1Cn1ccnc1-c1ccccn1 |
| InChI | InChI=1S/C16H19N7/c1-2-5-12-14(20-10-15(21-12)22-17)11-23-9-8-19-16(23)13-6-3-4-7-18-13/h3-4,6-10H,2,5,11,17H2,1H3,(H,21,22) |
| InChIKey | AXWCOLJGNRZLHV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|