C19H23NO5 — CID 58750339
(6Z,12E)-18-hydroxy-16-(2-hydroxyethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 58750339) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (6Z,12E)-18-hydroxy-16-(2-hydroxyethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (6Z,12E)-18-hydroxy-16-(2-hydroxyethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 58750339 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (6Z,12E)-18-hydroxy-16-(2-hydroxyethylamino)-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | O=C1/C=C\CCOC(=O)c2c(O)cc(NCCO)cc2/C=C/CCC1 |
| InChI | InChI=1S/C19H23NO5/c21-10-9-20-15-12-14-6-2-1-3-7-16(22)8-4-5-11-25-19(24)18(14)17(23)13-15/h2,4,6,8,12-13,20-21,23H,1,3,5,7,9-11H2/b6-2+,8-4- |
| InChIKey | PAZZHEDGPZEYQL-XATRDHJGSA-N |
| XLogP | 2.67 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |