C21H23NO8S — CID 58750390
N-[[(6Z,10S,12E)-10,21-dihydroxy-2,8-dioxo-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaen-17-yl]methyl]methanesulfonamide (PubChem CID 58750390) has the molecular formula C21H23NO8S and a molecular weight of 449.48 g/mol. Its IUPAC name is N-[[(6Z,10S,12E)-10,21-dihydroxy-2,8-dioxo-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaen-17-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(6Z,10S,12E)-10,21-dihydroxy-2,8-dioxo-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaen-17-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 58750390 |
| Molecular Formula | C21H23NO8S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-[[(6Z,10S,12E)-10,21-dihydroxy-2,8-dioxo-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaen-17-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1cc2c3c(c(O)cc2o1)C(=O)OCC/C=C\C(=O)C[C@@H](O)C/C=C/3 |
| InChI | InChI=1S/C21H23NO8S/c1-31(27,28)22-12-15-10-17-16-7-4-6-14(24)9-13(23)5-2-3-8-29-21(26)20(16)18(25)11-19(17)30-15/h2,4-5,7,10-11,14,22,24-25H,3,6,8-9,12H2,1H3/b5-2-,7-4+/t14-/m0/s1 |
| InChIKey | YXMRINOOYHAMCS-BZSSBEGZSA-N |
| XLogP | 2.03 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |