C23H29NO9S — CID 91057831
N-[[(4S,5R,9S,10S)-8,9,10,21-tetrahydroxy-4,5-dimethyl-2-oxo-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaen-17-yl]methyl]methanesulfonamide (PubChem CID 91057831) has the molecular formula C23H29NO9S and a molecular weight of 495.55 g/mol. Its IUPAC name is N-[[(4S,5R,9S,10S)-8,9,10,21-tetrahydroxy-4,5-dimethyl-2-oxo-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaen-17-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(4S,5R,9S,10S)-8,9,10,21-tetrahydroxy-4,5-dimethyl-2-oxo-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaen-17-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 91057831 |
| Molecular Formula | C23H29NO9S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-[[(4S,5R,9S,10S)-8,9,10,21-tetrahydroxy-4,5-dimethyl-2-oxo-3,18-dioxatricyclo[12.7.0.015,19]henicosa-1(14),6,12,15(19),16,20-hexaen-17-yl]methyl]methanesulfonamide |
| SMILES | C[C@@H]1C=CC(O)[C@@H](O)[C@@H](O)CC=Cc2c(c(O)cc3oc(CNS(C)(=O)=O)cc23)C(=O)O[C@H]1C |
| InChI | InChI=1S/C23H29NO9S/c1-12-7-8-18(26)22(28)17(25)6-4-5-15-16-9-14(11-24-34(3,30)31)33-20(16)10-19(27)21(15)23(29)32-13(12)2/h4-5,7-10,12-13,17-18,22,24-28H,6,11H2,1-3H3/t12-,13+,17+,18?,22+/m1/s1 |
| InChIKey | CNAICOKWNPDGLN-CWFSOARISA-N |
| XLogP | 1.42 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|