C22H26N2O6 — CID 142805986
(5R,6Z,12E)-18-ethyl-9,10,21-trihydroxy-4,5-dimethyl-3-oxa-16,18-diazatricyclo[12.7.0.015,19]henicosa-1(21),6,12,14,16,19-hexaene-2,8-dione (PubChem CID 142805986) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is (5R,6Z,12E)-18-ethyl-9,10,21-trihydroxy-4,5-dimethyl-3-oxa-16,18-diazatricyclo[12.7.0.015,19]henicosa-1(21),6,12,14,16,19-hexaene-2,8-dione.
| Compound Name | (5R,6Z,12E)-18-ethyl-9,10,21-trihydroxy-4,5-dimethyl-3-oxa-16,18-diazatricyclo[12.7.0.015,19]henicosa-1(21),6,12,14,16,19-hexaene-2,8-dione |
|---|---|
| PubChem CID | 142805986 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (5R,6Z,12E)-18-ethyl-9,10,21-trihydroxy-4,5-dimethyl-3-oxa-16,18-diazatricyclo[12.7.0.015,19]henicosa-1(21),6,12,14,16,19-hexaene-2,8-dione |
| SMILES | CCn1cnc2c3c(c(O)cc21)C(=O)OC(C)[C@H](C)/C=C\C(=O)C(O)C(O)C/C=C/3 |
| InChI | InChI=1S/C22H26N2O6/c1-4-24-11-23-20-14-6-5-7-16(25)21(28)17(26)9-8-12(2)13(3)30-22(29)19(14)18(27)10-15(20)24/h5-6,8-13,16,21,25,27-28H,4,7H2,1-3H3/b6-5+,9-8-/t12-,13?,16?,21?/m1/s1 |
| InChIKey | VIJHFFKWROTCNY-CWJYKKGRSA-N |
| XLogP | 2.21 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |