C28H28F3N3O4 — CID 58750942
(2S,3S)-2-[[(5S,11bR)-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 58750942) has the molecular formula C28H28F3N3O4 and a molecular weight of 527.54 g/mol. Its IUPAC name is (2S,3S)-2-[[(5S,11bR)-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(5S,11bR)-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 58750942 |
| Molecular Formula | C28H28F3N3O4 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (2S,3S)-2-[[(5S,11bR)-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2CC(c3cccc(C(F)(F)F)c3)C(=O)N21)C(=O)O |
| InChI | InChI=1S/C28H28F3N3O4/c1-3-14(2)23(27(37)38)33-25(35)22-13-19-17-9-4-5-10-20(17)32-24(19)21-12-18(26(36)34(21)22)15-7-6-8-16(11-15)28(29,30)31/h4-11,14,18,21-23,32H,3,12-13H2,1-2H3,(H,33,35)(H,37,38)/t14-,18?,21+,22-,23-/m0/s1 |
| InChIKey | MAILNEOULJVNNK-VWGUCONMSA-N |
| XLogP | 4.78 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|