C26H26ClN3O6S — CID 58751633
benzyl N-[6-[[(3aR,6aR)-2-(hydroxycarbamoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]sulfonyl]-1-chloronaphthalen-2-yl]carbamate (PubChem CID 58751633) has the molecular formula C26H26ClN3O6S and a molecular weight of 544.03 g/mol. Its IUPAC name is benzyl N-[6-[[(3aR,6aR)-2-(hydroxycarbamoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]sulfonyl]-1-chloronaphthalen-2-yl]carbamate.
| Compound Name | benzyl N-[6-[[(3aR,6aR)-2-(hydroxycarbamoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]sulfonyl]-1-chloronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 58751633 |
| Molecular Formula | C26H26ClN3O6S |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | benzyl N-[6-[[(3aR,6aR)-2-(hydroxycarbamoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]sulfonyl]-1-chloronaphthalen-2-yl]carbamate |
| SMILES | O=C(Nc1ccc2cc(S(=O)(=O)N3C(C(=O)NO)C[C@H]4CCC[C@H]43)ccc2c1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C26H26ClN3O6S/c27-24-20-11-10-19(37(34,35)30-22-8-4-7-18(22)14-23(30)25(31)29-33)13-17(20)9-12-21(24)28-26(32)36-15-16-5-2-1-3-6-16/h1-3,5-6,9-13,18,22-23,33H,4,7-8,14-15H2,(H,28,32)(H,29,31)/t18-,22-,23?/m1/s1 |
| InChIKey | KQGIRIUHGJADDN-QRJSWGNPSA-N |
| XLogP | 4.68 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|