C18H18Cl2N2O5S — CID 70684920
(2R,3S)-1-(3,4-dichlorophenyl)sulfonyl-N-hydroxy-3-phenylmethoxypyrrolidine-2-carboxamide (PubChem CID 70684920) has the molecular formula C18H18Cl2N2O5S and a molecular weight of 445.32 g/mol. Its IUPAC name is (2R,3S)-1-(3,4-dichlorophenyl)sulfonyl-N-hydroxy-3-phenylmethoxypyrrolidine-2-carboxamide.
| Compound Name | (2R,3S)-1-(3,4-dichlorophenyl)sulfonyl-N-hydroxy-3-phenylmethoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70684920 |
| Molecular Formula | C18H18Cl2N2O5S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | (2R,3S)-1-(3,4-dichlorophenyl)sulfonyl-N-hydroxy-3-phenylmethoxypyrrolidine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1[C@@H](OCc2ccccc2)CCN1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O5S/c19-14-7-6-13(10-15(14)20)28(25,26)22-9-8-16(17(22)18(23)21-24)27-11-12-4-2-1-3-5-12/h1-7,10,16-17,24H,8-9,11H2,(H,21,23)/t16-,17+/m0/s1 |
| InChIKey | CEAWBTVLSNHIPG-DLBZAZTESA-N |
| XLogP | 2.85 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|