C9H12N2O4S2 — CID 58755395
(E)-2-[4-(methanesulfonamido)phenyl]ethenesulfonamide (PubChem CID 58755395) has the molecular formula C9H12N2O4S2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (E)-2-[4-(methanesulfonamido)phenyl]ethenesulfonamide.
| Compound Name | (E)-2-[4-(methanesulfonamido)phenyl]ethenesulfonamide |
|---|---|
| PubChem CID | 58755395 |
| Molecular Formula | C9H12N2O4S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (E)-2-[4-(methanesulfonamido)phenyl]ethenesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C9H12N2O4S2/c1-16(12,13)11-9-4-2-8(3-5-9)6-7-17(10,14)15/h2-7,11H,1H3,(H2,10,14,15)/b7-6+ |
| InChIKey | YMOGDLNYXPGMBS-VOTSOKGWSA-N |
| XLogP | 0.32 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |