C9H11NNaO5S2 — CID 173016120
CID 173016120 (PubChem CID 173016120) has the molecular formula C9H11NNaO5S2 and a molecular weight of 300.31 g/mol.
| Compound Name | CID 173016120 |
|---|---|
| PubChem CID | 173016120 |
| Molecular Formula | C9H11NNaO5S2 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc(C=CS(=O)(=O)O)cc1.[Na] |
| InChI | InChI=1S/C9H11NO5S2.Na/c1-16(11,12)10-9-4-2-8(3-5-9)6-7-17(13,14)15;/h2-7,10H,1H3,(H,13,14,15); |
| InChIKey | BHSYPYJWUBHGSP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|