C10H17N5O4 — CID 58757792
N-[4-[hydroxymethyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide (PubChem CID 58757792) has the molecular formula C10H17N5O4 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-[4-[hydroxymethyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide.
| Compound Name | N-[4-[hydroxymethyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide |
|---|---|
| PubChem CID | 58757792 |
| Molecular Formula | C10H17N5O4 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-[4-[hydroxymethyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide |
| SMILES | COCN(CO)c1ncnc(N(COC)C(C)=O)n1 |
| InChI | InChI=1S/C10H17N5O4/c1-8(17)15(7-19-3)10-12-4-11-9(13-10)14(5-16)6-18-2/h4,16H,5-7H2,1-3H3 |
| InChIKey | WOBCNISTAFSVKY-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|