C11H17N5O4 — CID 58757793
N-[4-[acetyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide (PubChem CID 58757793) has the molecular formula C11H17N5O4 and a molecular weight of 283.28 g/mol. Its IUPAC name is N-[4-[acetyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide.
| Compound Name | N-[4-[acetyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide |
|---|---|
| PubChem CID | 58757793 |
| Molecular Formula | C11H17N5O4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[4-[acetyl(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide |
| SMILES | CC(=O)N(COC)C1=NC(=NC=N1)N(COC)C(=O)C |
| InChI | InChI=1S/C11H17N5O4/c1-8(17)15(6-19-3)10-12-5-13-11(14-10)16(7-20-4)9(2)18/h5H,6-7H2,1-4H3 |
| InChIKey | CTZAMCYNLVTYIS-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 97.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 311 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|