C17H24O4 — CID 58757986
(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-(acetyloxymethyl)prop-2-enoate (PubChem CID 58757986) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-(acetyloxymethyl)prop-2-enoate.
| Compound Name | (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-(acetyloxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 58757986 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-(acetyloxymethyl)prop-2-enoate |
| SMILES | C=C(COC(C)=O)C(=O)OC1(C)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H24O4/c1-10(9-20-11(2)18)16(19)21-17(3)8-12-7-15(17)14-6-4-5-13(12)14/h12-15H,1,4-9H2,2-3H3 |
| InChIKey | HUYDWIMTXUYJAA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|