C14H19IO2 — CID 66596120
(8-iodo-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate (PubChem CID 66596120) has the molecular formula C14H19IO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is (8-iodo-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate.
| Compound Name | (8-iodo-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66596120 |
| Molecular Formula | C14H19IO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (8-iodo-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(I)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C14H19IO2/c1-8(2)13(16)17-14(15)7-9-6-12(14)11-5-3-4-10(9)11/h9-12H,1,3-7H2,2H3 |
| InChIKey | GKELWTCIFHRGHN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|