C16H26O2 — CID 145027666
8-methoxy-8-methyltricyclo[5.2.1.02,6]decane;2-methylprop-2-enal (PubChem CID 145027666) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 8-methoxy-8-methyltricyclo[5.2.1.02,6]decane;2-methylprop-2-enal.
| Compound Name | 8-methoxy-8-methyltricyclo[5.2.1.02,6]decane;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145027666 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 8-methoxy-8-methyltricyclo[5.2.1.02,6]decane;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.COC1(C)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C12H20O.C4H6O/c1-12(13-2)7-8-6-11(12)10-5-3-4-9(8)10;1-4(2)3-5/h8-11H,3-7H2,1-2H3;3H,1H2,2H3 |
| InChIKey | XPOAWDBTNCYRCH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|