C6H11BrO3 — CID 58758219
(2S,3R,4S)-4-bromo-5-(hydroxymethyl)-2-methyloxolan-3-ol (PubChem CID 58758219) has the molecular formula C6H11BrO3 and a molecular weight of 211.06 g/mol. Its IUPAC name is (2S,3R,4S)-4-bromo-5-(hydroxymethyl)-2-methyloxolan-3-ol.
| Compound Name | (2S,3R,4S)-4-bromo-5-(hydroxymethyl)-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 58758219 |
| Molecular Formula | C6H11BrO3 |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | (2S,3R,4S)-4-bromo-5-(hydroxymethyl)-2-methyloxolan-3-ol |
| SMILES | C[C@@H]1OC(CO)[C@@H](Br)[C@@H]1O |
| InChI | InChI=1S/C6H11BrO3/c1-3-6(9)5(7)4(2-8)10-3/h3-6,8-9H,2H2,1H3/t3-,4?,5+,6+/m0/s1 |
| InChIKey | JFQJNLLIADWOSH-UQIFEBIISA-N |
| XLogP | -0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|