C6H11BrO4 — CID 132529245
(2R,3R,4S,5R)-4-bromo-2,5-bis(hydroxymethyl)oxolan-3-ol (PubChem CID 132529245) has the molecular formula C6H11BrO4 and a molecular weight of 227.05 g/mol. Its IUPAC name is (2R,3R,4S,5R)-4-bromo-2,5-bis(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-4-bromo-2,5-bis(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 132529245 |
| Molecular Formula | C6H11BrO4 |
| Molecular Weight | 227.05 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | (2R,3R,4S,5R)-4-bromo-2,5-bis(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@H](CO)[C@@H](Br)[C@@H]1O |
| InChI | InChI=1S/C6H11BrO4/c7-5-3(1-8)11-4(2-9)6(5)10/h3-6,8-10H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | DYDCMRQKUMEBEU-KVTDHHQDSA-N |
| XLogP | -1.14 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.05 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|