C6H12O4S — CID 89267743
2,5-bis(hydroxymethyl)-4-sulfanyloxolan-3-ol (PubChem CID 89267743) has the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. Its IUPAC name is 2,5-bis(hydroxymethyl)-4-sulfanyloxolan-3-ol.
| Compound Name | 2,5-bis(hydroxymethyl)-4-sulfanyloxolan-3-ol |
|---|---|
| PubChem CID | 89267743 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2,5-bis(hydroxymethyl)-4-sulfanyloxolan-3-ol |
| SMILES | OCC1OC(CO)C(S)C1O |
| InChI | InChI=1S/C6H12O4S/c7-1-3-5(9)6(11)4(2-8)10-3/h3-9,11H,1-2H2 |
| InChIKey | VOBNGWJICDXCOB-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|