C13H14BrN3OSi — CID 58758496
[5-bromo-3-(1,3-oxazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-trimethylsilane (PubChem CID 58758496) has the molecular formula C13H14BrN3OSi and a molecular weight of 336.27 g/mol. Its IUPAC name is [5-bromo-3-(1,3-oxazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-trimethylsilane.
| Compound Name | [5-bromo-3-(1,3-oxazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 58758496 |
| Molecular Formula | C13H14BrN3OSi |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | [5-bromo-3-(1,3-oxazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1[nH]c2ncc(Br)cc2c1-c1cnco1 |
| InChI | InChI=1S/C13H14BrN3OSi/c1-19(2,3)13-11(10-6-15-7-18-10)9-4-8(14)5-16-12(9)17-13/h4-7H,1-3H3,(H,16,17) |
| InChIKey | MBDKQYMAWBBARX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|