C24H24N4O5 — CID 58758728
2-[4-[1-[(4-aminophenyl)methyl]-2,4-dioxo-3-propyl-5H-pyrrolo[3,2-d]pyrimidin-6-yl]phenoxy]acetic acid (PubChem CID 58758728) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-[4-[1-[(4-aminophenyl)methyl]-2,4-dioxo-3-propyl-5H-pyrrolo[3,2-d]pyrimidin-6-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[1-[(4-aminophenyl)methyl]-2,4-dioxo-3-propyl-5H-pyrrolo[3,2-d]pyrimidin-6-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 58758728 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-[4-[1-[(4-aminophenyl)methyl]-2,4-dioxo-3-propyl-5H-pyrrolo[3,2-d]pyrimidin-6-yl]phenoxy]acetic acid |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(OCC(=O)O)cc3)cc2n(Cc2ccc(N)cc2)c1=O |
| InChI | InChI=1S/C24H24N4O5/c1-2-11-27-23(31)22-20(28(24(27)32)13-15-3-7-17(25)8-4-15)12-19(26-22)16-5-9-18(10-6-16)33-14-21(29)30/h3-10,12,26H,2,11,13-14,25H2,1H3,(H,29,30) |
| InChIKey | WITHLGGZVBRXOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 132.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|