C21H16BrClFNO3S — CID 58760777
ethyl 1-bromo-10-(4-chlorophenyl)sulfanyl-3-fluoro-9-oxo-7,8-dihydro-6H-pyrido[1,2-a]indole-8-carboxylate (PubChem CID 58760777) has the molecular formula C21H16BrClFNO3S and a molecular weight of 496.79 g/mol. Its IUPAC name is ethyl 1-bromo-10-(4-chlorophenyl)sulfanyl-3-fluoro-9-oxo-7,8-dihydro-6H-pyrido[1,2-a]indole-8-carboxylate.
| Compound Name | ethyl 1-bromo-10-(4-chlorophenyl)sulfanyl-3-fluoro-9-oxo-7,8-dihydro-6H-pyrido[1,2-a]indole-8-carboxylate |
|---|---|
| PubChem CID | 58760777 |
| Molecular Formula | C21H16BrClFNO3S |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | ethyl 1-bromo-10-(4-chlorophenyl)sulfanyl-3-fluoro-9-oxo-7,8-dihydro-6H-pyrido[1,2-a]indole-8-carboxylate |
| SMILES | CCOC(=O)C1CCn2c(c(Sc3ccc(Cl)cc3)c3c(Br)cc(F)cc32)C1=O |
| InChI | InChI=1S/C21H16BrClFNO3S/c1-2-28-21(27)14-7-8-25-16-10-12(24)9-15(22)17(16)20(18(25)19(14)26)29-13-5-3-11(23)4-6-13/h3-6,9-10,14H,2,7-8H2,1H3 |
| InChIKey | GLLZYNSWLKZZQV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|