C14H12BrCl2NO2 — CID 170426679
ethyl 5-bromo-7,8-dichloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-3-carboxylate (PubChem CID 170426679) has the molecular formula C14H12BrCl2NO2 and a molecular weight of 377.07 g/mol. Its IUPAC name is ethyl 5-bromo-7,8-dichloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-3-carboxylate.
| Compound Name | ethyl 5-bromo-7,8-dichloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-3-carboxylate |
|---|---|
| PubChem CID | 170426679 |
| Molecular Formula | C14H12BrCl2NO2 |
| Molecular Weight | 377.07 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | ethyl 5-bromo-7,8-dichloro-2,3-dihydro-1H-pyrrolo[1,2-a]indole-3-carboxylate |
| SMILES | CCOC(=O)C1CCn2c1cc1c(Br)cc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C14H12BrCl2NO2/c1-2-20-14(19)7-3-4-18-11(7)5-8-9(15)6-10(16)12(17)13(8)18/h5-7H,2-4H2,1H3 |
| InChIKey | TUPAASPCCODPHG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.07 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|