C8H10N2O2ReRf-2 — CID 58760786
3a,6a-dimethyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-1,3-diide-4,6-dione;rhenium;rutherfordium (PubChem CID 58760786) has the molecular formula C8H10N2O2ReRf-2 and a molecular weight of 619.39 g/mol. Its IUPAC name is 3a,6a-dimethyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-1,3-diide-4,6-dione;rhenium;rutherfordium.
| Compound Name | 3a,6a-dimethyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-1,3-diide-4,6-dione;rhenium;rutherfordium |
|---|---|
| PubChem CID | 58760786 |
| Molecular Formula | C8H10N2O2ReRf-2 |
| Molecular Weight | 619.39 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | 3a,6a-dimethyl-2,3-dihydro-1H-pyrrolo[3,4-c]pyrrole-1,3-diide-4,6-dione;rhenium;rutherfordium |
| SMILES | CC12[CH-]N[CH-]C1(C)C(=O)NC2=O.[Re].[Rf] |
| InChI | InChI=1S/C8H10N2O2.Re.Rf/c1-7-3-9-4-8(7,2)6(12)10-5(7)11;;/h3-4,9H,1-2H3,(H,10,11,12);;/q-2;; |
| InChIKey | MXENDCRBLCDUDG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|