C12H18NY- — CID 58763043
5-methyl-2,3-di(propan-2-yl)-4H-pyridin-4-ide;yttrium (PubChem CID 58763043) has the molecular formula C12H18NY- and a molecular weight of 265.19 g/mol. Its IUPAC name is 5-methyl-2,3-di(propan-2-yl)-4H-pyridin-4-ide;yttrium.
| Compound Name | 5-methyl-2,3-di(propan-2-yl)-4H-pyridin-4-ide;yttrium |
|---|---|
| PubChem CID | 58763043 |
| Molecular Formula | C12H18NY- |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 5-methyl-2,3-di(propan-2-yl)-4H-pyridin-4-ide;yttrium |
| SMILES | Cc1[c-]c(C(C)C)c(C(C)C)nc1.[Y] |
| InChI | InChI=1S/C12H18N.Y/c1-8(2)11-6-10(5)7-13-12(11)9(3)4;/h7-9H,1-5H3;/q-1; |
| InChIKey | NDJDIVVUXKKUGU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|