C16H21NY-2 — CID 59889957
ethane;3,5,6,7,8-pentamethyl-4H-quinolin-4-ide;yttrium (PubChem CID 59889957) has the molecular formula C16H21NY-2 and a molecular weight of 316.26 g/mol. Its IUPAC name is ethane;3,5,6,7,8-pentamethyl-4H-quinolin-4-ide;yttrium.
| Compound Name | ethane;3,5,6,7,8-pentamethyl-4H-quinolin-4-ide;yttrium |
|---|---|
| PubChem CID | 59889957 |
| Molecular Formula | C16H21NY-2 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | ethane;3,5,6,7,8-pentamethyl-4H-quinolin-4-ide;yttrium |
| SMILES | Cc1[c-]c2c(C)c(C)c(C)c(C)c2nc1.[CH2-]C.[Y] |
| InChI | InChI=1S/C14H16N.C2H5.Y/c1-8-6-13-11(4)9(2)10(3)12(5)14(13)15-7-8;1-2;/h7H,1-5H3;1H2,2H3;/q2*-1; |
| InChIKey | XTKGRDDAFODEHT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|