C18H18FN3O3 — CID 58763334
benzyl (2S)-2-[(6-fluoro-2-pyridinyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 58763334) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is benzyl (2S)-2-[(6-fluoro-2-pyridinyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[(6-fluoro-2-pyridinyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58763334 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | benzyl (2S)-2-[(6-fluoro-2-pyridinyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1cccc(F)n1)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H18FN3O3/c19-15-9-4-10-16(20-15)21-17(23)14-8-5-11-22(14)18(24)25-12-13-6-2-1-3-7-13/h1-4,6-7,9-10,14H,5,8,11-12H2,(H,20,21,23)/t14-/m0/s1 |
| InChIKey | WSPFJBJIFURCDB-AWEZNQCLSA-N |
| XLogP | 2.96 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|