C26H34N2O4S — CID 58763389
5-[2-[(1S,3S)-3-[[2-(3,4-dimethylphenyl)-5-propan-2-yl-1,3-oxazol-4-yl]methoxy]cyclohexyl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 58763389) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is 5-[2-[(1S,3S)-3-[[2-(3,4-dimethylphenyl)-5-propan-2-yl-1,3-oxazol-4-yl]methoxy]cyclohexyl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[2-[(1S,3S)-3-[[2-(3,4-dimethylphenyl)-5-propan-2-yl-1,3-oxazol-4-yl]methoxy]cyclohexyl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58763389 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 5-[2-[(1S,3S)-3-[[2-(3,4-dimethylphenyl)-5-propan-2-yl-1,3-oxazol-4-yl]methoxy]cyclohexyl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2nc(CO[C@H]3CCC[C@@H](CCC4SC(=O)NC4=O)C3)c(C(C)C)o2)cc1C |
| InChI | InChI=1S/C26H34N2O4S/c1-15(2)23-21(27-25(32-23)19-10-8-16(3)17(4)12-19)14-31-20-7-5-6-18(13-20)9-11-22-24(29)28-26(30)33-22/h8,10,12,15,18,20,22H,5-7,9,11,13-14H2,1-4H3,(H,28,29,30)/t18-,20-,22?/m0/s1 |
| InChIKey | DGJZOMHXERRZBD-LCODYBDSSA-N |
| XLogP | 6.29 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|