C20H24FNO3 — CID 142936496
3-[(1S,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]propanal (PubChem CID 142936496) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-[(1S,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]propanal.
| Compound Name | 3-[(1S,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]propanal |
|---|---|
| PubChem CID | 142936496 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-[(1S,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]propanal |
| SMILES | Cc1oc(-c2ccc(F)cc2)nc1CO[C@H]1CCC[C@@H](CCC=O)C1 |
| InChI | InChI=1S/C20H24FNO3/c1-14-19(22-20(25-14)16-7-9-17(21)10-8-16)13-24-18-6-2-4-15(12-18)5-3-11-23/h7-11,15,18H,2-6,12-13H2,1H3/t15-,18-/m0/s1 |
| InChIKey | QAPHPQYXUIBSKR-YJBOKZPZSA-N |
| XLogP | 4.84 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|