C24H27FN2O3 — CID 89165886
2-[[3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxymethyl]aniline (PubChem CID 89165886) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is 2-[[3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxymethyl]aniline.
| Compound Name | 2-[[3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxymethyl]aniline |
|---|---|
| PubChem CID | 89165886 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[[3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxymethyl]aniline |
| SMILES | Cc1oc(-c2ccc(F)cc2)nc1COC1CCCC(OCc2ccccc2N)C1 |
| InChI | InChI=1S/C24H27FN2O3/c1-16-23(27-24(30-16)17-9-11-19(25)12-10-17)15-29-21-7-4-6-20(13-21)28-14-18-5-2-3-8-22(18)26/h2-3,5,8-12,20-21H,4,6-7,13-15,26H2,1H3 |
| InChIKey | HOYOVIRFFPLHAI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|