C24H25FN2O7S — CID 87937742
[(1S,3R)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 87937742) has the molecular formula C24H25FN2O7S and a molecular weight of 504.54 g/mol. Its IUPAC name is [(1S,3R)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [(1S,3R)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 87937742 |
| Molecular Formula | C24H25FN2O7S |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [(1S,3R)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCC[C@@H](OCc3nc(-c4ccc(F)cc4)oc3C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H25FN2O7S/c1-15-6-11-21(13-23(15)27(28)29)35(30,31)34-20-5-3-4-19(12-20)32-14-22-16(2)33-24(26-22)17-7-9-18(25)10-8-17/h6-11,13,19-20H,3-5,12,14H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | SPDDXEKZTUWEGZ-UXHICEINSA-N |
| XLogP | 5.24 |
| TPSA | 121.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|