C25H32FNO5 — CID 66889113
ethyl 2-ethyl-4-[(1R,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxybut-2-enoate (PubChem CID 66889113) has the molecular formula C25H32FNO5 and a molecular weight of 445.53 g/mol. Its IUPAC name is ethyl 2-ethyl-4-[(1R,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxybut-2-enoate.
| Compound Name | ethyl 2-ethyl-4-[(1R,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxybut-2-enoate |
|---|---|
| PubChem CID | 66889113 |
| Molecular Formula | C25H32FNO5 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | ethyl 2-ethyl-4-[(1R,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]oxybut-2-enoate |
| SMILES | CCOC(=O)C(=CCO[C@@H]1CCC[C@H](OCc2nc(-c3ccc(F)cc3)oc2C)C1)CC |
| InChI | InChI=1S/C25H32FNO5/c1-4-18(25(28)29-5-2)13-14-30-21-7-6-8-22(15-21)31-16-23-17(3)32-24(27-23)19-9-11-20(26)12-10-19/h9-13,21-22H,4-8,14-16H2,1-3H3/t21-,22+/m1/s1 |
| InChIKey | MVHIIPHBVXIUCL-YADHBBJMSA-N |
| XLogP | 5.53 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|