C24H22FN3O8 — CID 87937702
[(1R,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl] 3,5-dinitrobenzoate (PubChem CID 87937702) has the molecular formula C24H22FN3O8 and a molecular weight of 499.45 g/mol. Its IUPAC name is [(1R,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl] 3,5-dinitrobenzoate.
| Compound Name | [(1R,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 87937702 |
| Molecular Formula | C24H22FN3O8 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | [(1R,3S)-3-[[2-(4-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]cyclohexyl] 3,5-dinitrobenzoate |
| SMILES | Cc1oc(-c2ccc(F)cc2)nc1CO[C@H]1CCC[C@@H](OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C24H22FN3O8/c1-14-22(26-23(35-14)15-5-7-17(25)8-6-15)13-34-20-3-2-4-21(12-20)36-24(29)16-9-18(27(30)31)11-19(10-16)28(32)33/h5-11,20-21H,2-4,12-13H2,1H3/t20-,21+/m0/s1 |
| InChIKey | XYZFPPGDZJZCQZ-LEWJYISDSA-N |
| XLogP | 5.29 |
| TPSA | 147.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|