C25H27FN2O6 — CID 68858990
2-(4-fluorophenyl)-4-[[(1S,3R)-3-[(2-methoxy-5-nitrophenyl)methoxy]cyclohexyl]oxymethyl]-5-methyl-1,3-oxazole (PubChem CID 68858990) has the molecular formula C25H27FN2O6 and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[[(1S,3R)-3-[(2-methoxy-5-nitrophenyl)methoxy]cyclohexyl]oxymethyl]-5-methyl-1,3-oxazole.
| Compound Name | 2-(4-fluorophenyl)-4-[[(1S,3R)-3-[(2-methoxy-5-nitrophenyl)methoxy]cyclohexyl]oxymethyl]-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 68858990 |
| Molecular Formula | C25H27FN2O6 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[[(1S,3R)-3-[(2-methoxy-5-nitrophenyl)methoxy]cyclohexyl]oxymethyl]-5-methyl-1,3-oxazole |
| SMILES | COc1ccc([N+](=O)[O-])cc1CO[C@@H]1CCC[C@H](OCc2nc(-c3ccc(F)cc3)oc2C)C1 |
| InChI | InChI=1S/C25H27FN2O6/c1-16-23(27-25(34-16)17-6-8-19(26)9-7-17)15-33-22-5-3-4-21(13-22)32-14-18-12-20(28(29)30)10-11-24(18)31-2/h6-12,21-22H,3-5,13-15H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | MFCVMCAZNVCYOT-YADHBBJMSA-N |
| XLogP | 5.75 |
| TPSA | 96.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|