C25H26F6N2O4S — CID 87938234
5-[2-[(1S,3S)-3-[[2-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 87938234) has the molecular formula C25H26F6N2O4S and a molecular weight of 564.55 g/mol. Its IUPAC name is 5-[2-[(1S,3S)-3-[[2-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[2-[(1S,3S)-3-[[2-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87938234 |
| Molecular Formula | C25H26F6N2O4S |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 5-[2-[(1S,3S)-3-[[2-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1,3-oxazol-4-yl]methoxy]cyclohexyl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1oc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc1CO[C@H]1CCC[C@@H](CCC2SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C25H26F6N2O4S/c1-2-19-18(12-36-17-5-3-4-13(8-17)6-7-20-21(34)33-23(35)38-20)32-22(37-19)14-9-15(24(26,27)28)11-16(10-14)25(29,30)31/h9-11,13,17,20H,2-8,12H2,1H3,(H,33,34,35)/t13-,17-,20?/m0/s1 |
| InChIKey | MRHWDGXXKSBRJK-GGWFGGLOSA-N |
| XLogP | 7.15 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|