C22H30N3+ — CID 58764329
2-ethyl-1-pentan-3-yl-5-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-1-ium (PubChem CID 58764329) has the molecular formula C22H30N3+ and a molecular weight of 336.50 g/mol. Its IUPAC name is 2-ethyl-1-pentan-3-yl-5-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-1-ium.
| Compound Name | 2-ethyl-1-pentan-3-yl-5-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-1-ium |
|---|---|
| PubChem CID | 58764329 |
| Molecular Formula | C22H30N3+ |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 2-ethyl-1-pentan-3-yl-5-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-1-ium |
| SMILES | CCc1nn2c(-c3c(C)cc(C)cc3C)cccc2[n+]1C(CC)CC |
| InChI | InChI=1S/C22H30N3/c1-7-18(8-2)24-20(9-3)23-25-19(11-10-12-21(24)25)22-16(5)13-15(4)14-17(22)6/h10-14,18H,7-9H2,1-6H3/q+1 |
| InChIKey | CQNBIZUDPOMRND-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|